C25H25N3O3S — CID 24597130
1-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-naphthalen-2-yloxypropan-2-ol (PubChem CID 24597130) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is 1-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-naphthalen-2-yloxypropan-2-ol.
| Compound Name | 1-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-naphthalen-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 24597130 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 1-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-naphthalen-2-yloxypropan-2-ol |
| SMILES | C=CCn1c(SCC(O)COc2ccc3ccccc3c2)nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H25N3O3S/c1-3-14-28-24(19-9-11-22(30-2)12-10-19)26-27-25(28)32-17-21(29)16-31-23-13-8-18-6-4-5-7-20(18)15-23/h3-13,15,21,29H,1,14,16-17H2,2H3 |
| InChIKey | IZOAWOFKCCDRHY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|