C28H28N4O2S — CID 41483562
N-benzhydryl-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-methylacetamide (PubChem CID 41483562) has the molecular formula C28H28N4O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is N-benzhydryl-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-methylacetamide.
| Compound Name | N-benzhydryl-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 41483562 |
| Molecular Formula | C28H28N4O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-benzhydryl-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-methylacetamide |
| SMILES | C=CCn1c(SCC(=O)N(C)C(c2ccccc2)c2ccccc2)nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H28N4O2S/c1-4-19-32-27(23-15-17-24(34-3)18-16-23)29-30-28(32)35-20-25(33)31(2)26(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h4-18,26H,1,19-20H2,2-3H3 |
| InChIKey | CDFPIDJMJLKRQG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|