C27H25FN4OS — CID 112784442
N-benzhydryl-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-methylacetamide (PubChem CID 112784442) has the molecular formula C27H25FN4OS and a molecular weight of 472.59 g/mol. Its IUPAC name is N-benzhydryl-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-methylacetamide.
| Compound Name | N-benzhydryl-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 112784442 |
| Molecular Formula | C27H25FN4OS |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-benzhydryl-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-methylacetamide |
| SMILES | C=CCn1c(SCC(=O)N(C)C(c2ccccc2)c2ccccc2)nnc1-c1ccccc1F |
| InChI | InChI=1S/C27H25FN4OS/c1-3-18-32-26(22-16-10-11-17-23(22)28)29-30-27(32)34-19-24(33)31(2)25(20-12-6-4-7-13-20)21-14-8-5-9-15-21/h3-17,25H,1,18-19H2,2H3 |
| InChIKey | OFAQKCWMCAFEEY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|