C22H20N4O2S — CID 7813861
2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-phenyl-1,3-oxazole (PubChem CID 7813861) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-phenyl-1,3-oxazole.
| Compound Name | 2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 7813861 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-5-phenyl-1,3-oxazole |
| SMILES | C=CCn1c(SCc2ncc(-c3ccccc3)o2)nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H20N4O2S/c1-3-13-26-21(17-9-11-18(27-2)12-10-17)24-25-22(26)29-15-20-23-14-19(28-20)16-7-5-4-6-8-16/h3-12,14H,1,13,15H2,2H3 |
| InChIKey | QMJNIMPTBOIPBG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|