C20H16ClN5OS — CID 78790261
5-(3-chlorophenyl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-oxazole (PubChem CID 78790261) has the molecular formula C20H16ClN5OS and a molecular weight of 409.90 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-oxazole.
| Compound Name | 5-(3-chlorophenyl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-oxazole |
|---|---|
| PubChem CID | 78790261 |
| Molecular Formula | C20H16ClN5OS |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 5-(3-chlorophenyl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-oxazole |
| SMILES | C=CCn1c(SCc2ncc(-c3cccc(Cl)c3)o2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C20H16ClN5OS/c1-2-10-26-19(14-6-8-22-9-7-14)24-25-20(26)28-13-18-23-12-17(27-18)15-4-3-5-16(21)11-15/h2-9,11-12H,1,10,13H2 |
| InChIKey | LYMLIRSKPLOVEH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|