C23H19ClN4S — CID 78606101
4-[5-[(4-chlorophenyl)-phenylmethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]pyridine (PubChem CID 78606101) has the molecular formula C23H19ClN4S and a molecular weight of 418.95 g/mol. Its IUPAC name is 4-[5-[(4-chlorophenyl)-phenylmethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[5-[(4-chlorophenyl)-phenylmethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 78606101 |
| Molecular Formula | C23H19ClN4S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 4-[5-[(4-chlorophenyl)-phenylmethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]pyridine |
| SMILES | C=CCn1c(SC(c2ccccc2)c2ccc(Cl)cc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C23H19ClN4S/c1-2-16-28-22(19-12-14-25-15-13-19)26-27-23(28)29-21(17-6-4-3-5-7-17)18-8-10-20(24)11-9-18/h2-15,21H,1,16H2 |
| InChIKey | UJMQEMUVPVKPLR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|