C17H17N5S — CID 78815809
2-[2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyridine (PubChem CID 78815809) has the molecular formula C17H17N5S and a molecular weight of 323.43 g/mol. Its IUPAC name is 2-[2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyridine.
| Compound Name | 2-[2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyridine |
|---|---|
| PubChem CID | 78815809 |
| Molecular Formula | C17H17N5S |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-[2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyridine |
| SMILES | C=CCn1c(SCCc2ccccn2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C17H17N5S/c1-2-12-22-16(14-6-10-18-11-7-14)20-21-17(22)23-13-8-15-5-3-4-9-19-15/h2-7,9-11H,1,8,12-13H2 |
| InChIKey | ODRYAYZRXULWLL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|