C18H14N6S — CID 78840249
2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]quinoxaline (PubChem CID 78840249) has the molecular formula C18H14N6S and a molecular weight of 346.42 g/mol. Its IUPAC name is 2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]quinoxaline.
| Compound Name | 2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]quinoxaline |
|---|---|
| PubChem CID | 78840249 |
| Molecular Formula | C18H14N6S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]quinoxaline |
| SMILES | C=CCn1c(Sc2cnc3ccccc3n2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C18H14N6S/c1-2-11-24-17(13-7-9-19-10-8-13)22-23-18(24)25-16-12-20-14-5-3-4-6-15(14)21-16/h2-10,12H,1,11H2 |
| InChIKey | NDGVPENIKDVMHU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|