C15H11N7S — CID 133492984
5-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyrazine-2-carbonitrile (PubChem CID 133492984) has the molecular formula C15H11N7S and a molecular weight of 321.37 g/mol. Its IUPAC name is 5-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyrazine-2-carbonitrile.
| Compound Name | 5-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133492984 |
| Molecular Formula | C15H11N7S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyrazine-2-carbonitrile |
| SMILES | C=CCn1c(Sc2cnc(C#N)cn2)nnc1-c1ccccn1 |
| InChI | InChI=1S/C15H11N7S/c1-2-7-22-14(12-5-3-4-6-17-12)20-21-15(22)23-13-10-18-11(8-16)9-19-13/h2-6,9-10H,1,7H2 |
| InChIKey | GUWBBGAOFGMJDQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 93.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|