C17H11ClFN5S — CID 99134664
5-chloro-6-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]pyridine-3-carbonitrile (PubChem CID 99134664) has the molecular formula C17H11ClFN5S and a molecular weight of 371.83 g/mol. Its IUPAC name is 5-chloro-6-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]pyridine-3-carbonitrile.
| Compound Name | 5-chloro-6-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 99134664 |
| Molecular Formula | C17H11ClFN5S |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 5-chloro-6-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]pyridine-3-carbonitrile |
| SMILES | C=CCn1c(Sc2ncc(C#N)cc2Cl)nnc1-c1ccccc1F |
| InChI | InChI=1S/C17H11ClFN5S/c1-2-7-24-15(12-5-3-4-6-14(12)19)22-23-17(24)25-16-13(18)8-11(9-20)10-21-16/h2-6,8,10H,1,7H2 |
| InChIKey | BAQVHAJWMBDZGA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|