C19H15Cl2FN4OS — CID 3918815
N-(3,4-dichlorophenyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3918815) has the molecular formula C19H15Cl2FN4OS and a molecular weight of 437.33 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3918815 |
| Molecular Formula | C19H15Cl2FN4OS |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(Cl)c(Cl)c2)nnc1-c1ccccc1F |
| InChI | InChI=1S/C19H15Cl2FN4OS/c1-2-9-26-18(13-5-3-4-6-16(13)22)24-25-19(26)28-11-17(27)23-12-7-8-14(20)15(21)10-12/h2-8,10H,1,9,11H2,(H,23,27) |
| InChIKey | CQHPQVWLDHCEAE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|