C28H21ClFN5OS — CID 19727675
N-(3-chloro-4-fluorophenyl)-2-[[5-(2-phenylquinolin-4-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19727675) has the molecular formula C28H21ClFN5OS and a molecular weight of 530.03 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[[5-(2-phenylquinolin-4-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[[5-(2-phenylquinolin-4-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19727675 |
| Molecular Formula | C28H21ClFN5OS |
| Molecular Weight | 530.03 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[[5-(2-phenylquinolin-4-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(F)c(Cl)c2)nnc1-c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C28H21ClFN5OS/c1-2-14-35-27(33-34-28(35)37-17-26(36)31-19-12-13-23(30)22(29)15-19)21-16-25(18-8-4-3-5-9-18)32-24-11-7-6-10-20(21)24/h2-13,15-16H,1,14,17H2,(H,31,36) |
| InChIKey | DULLSKYACBDOTI-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.03 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|