C28H22ClN5OS — CID 19727607
N-(2-chlorophenyl)-2-[[5-(2-phenylquinolin-4-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19727607) has the molecular formula C28H22ClN5OS and a molecular weight of 512.04 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[[5-(2-phenylquinolin-4-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[[5-(2-phenylquinolin-4-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19727607 |
| Molecular Formula | C28H22ClN5OS |
| Molecular Weight | 512.04 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | N-(2-chlorophenyl)-2-[[5-(2-phenylquinolin-4-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2Cl)nnc1-c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C28H22ClN5OS/c1-2-16-34-27(32-33-28(34)36-18-26(35)31-24-15-9-7-13-22(24)29)21-17-25(19-10-4-3-5-11-19)30-23-14-8-6-12-20(21)23/h2-15,17H,1,16,18H2,(H,31,35) |
| InChIKey | UEYKXAOGFYEYRP-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.04 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|