C28H21ClN4O2S — CID 46089515
4-[5-[(6-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-phenylquinoline (PubChem CID 46089515) has the molecular formula C28H21ClN4O2S and a molecular weight of 513.02 g/mol. Its IUPAC name is 4-[5-[(6-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-phenylquinoline.
| Compound Name | 4-[5-[(6-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-phenylquinoline |
|---|---|
| PubChem CID | 46089515 |
| Molecular Formula | C28H21ClN4O2S |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 4-[5-[(6-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-phenylquinoline |
| SMILES | C=CCn1c(SCc2cc3c(cc2Cl)OCO3)nnc1-c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C28H21ClN4O2S/c1-2-12-33-27(31-32-28(33)36-16-19-13-25-26(15-22(19)29)35-17-34-25)21-14-24(18-8-4-3-5-9-18)30-23-11-7-6-10-20(21)23/h2-11,13-15H,1,12,16-17H2 |
| InChIKey | YEVVBNLLXCBAHH-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|