C27H20BrFN4S — CID 46085131
4-[5-[(4-bromo-2-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-phenylquinoline (PubChem CID 46085131) has the molecular formula C27H20BrFN4S and a molecular weight of 531.45 g/mol. Its IUPAC name is 4-[5-[(4-bromo-2-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-phenylquinoline.
| Compound Name | 4-[5-[(4-bromo-2-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-phenylquinoline |
|---|---|
| PubChem CID | 46085131 |
| Molecular Formula | C27H20BrFN4S |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | 4-[5-[(4-bromo-2-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-phenylquinoline |
| SMILES | C=CCn1c(SCc2ccc(Br)cc2F)nnc1-c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C27H20BrFN4S/c1-2-14-33-26(31-32-27(33)34-17-19-12-13-20(28)15-23(19)29)22-16-25(18-8-4-3-5-9-18)30-24-11-7-6-10-21(22)24/h2-13,15-16H,1,14,17H2 |
| InChIKey | ZULGDHHFDOCCHQ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|