C22H18BrN3S — CID 19729459
3-(4-bromophenyl)-5-(naphthalen-1-ylmethylsulfanyl)-4-prop-2-enyl-1,2,4-triazole (PubChem CID 19729459) has the molecular formula C22H18BrN3S and a molecular weight of 436.38 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5-(naphthalen-1-ylmethylsulfanyl)-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(4-bromophenyl)-5-(naphthalen-1-ylmethylsulfanyl)-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 19729459 |
| Molecular Formula | C22H18BrN3S |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 3-(4-bromophenyl)-5-(naphthalen-1-ylmethylsulfanyl)-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2cccc3ccccc23)nnc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H18BrN3S/c1-2-14-26-21(17-10-12-19(23)13-11-17)24-25-22(26)27-15-18-8-5-7-16-6-3-4-9-20(16)18/h2-13H,1,14-15H2 |
| InChIKey | MQNQCYZROVJKMC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|