C22H21N3S2 — CID 19718704
3-(5-ethylthiophen-3-yl)-5-(naphthalen-1-ylmethylsulfanyl)-4-prop-2-enyl-1,2,4-triazole (PubChem CID 19718704) has the molecular formula C22H21N3S2 and a molecular weight of 391.57 g/mol. Its IUPAC name is 3-(5-ethylthiophen-3-yl)-5-(naphthalen-1-ylmethylsulfanyl)-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(5-ethylthiophen-3-yl)-5-(naphthalen-1-ylmethylsulfanyl)-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 19718704 |
| Molecular Formula | C22H21N3S2 |
| Molecular Weight | 391.57 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 3-(5-ethylthiophen-3-yl)-5-(naphthalen-1-ylmethylsulfanyl)-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2cccc3ccccc23)nnc1-c1csc(CC)c1 |
| InChI | InChI=1S/C22H21N3S2/c1-3-12-25-21(18-13-19(4-2)26-15-18)23-24-22(25)27-14-17-10-7-9-16-8-5-6-11-20(16)17/h3,5-11,13,15H,1,4,12,14H2,2H3 |
| InChIKey | SEDKPZHVWJZBKY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|