C19H20FN3S2 — CID 19719457
3-[(2-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazole (PubChem CID 19719457) has the molecular formula C19H20FN3S2 and a molecular weight of 373.52 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazole.
| Compound Name | 3-[(2-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 19719457 |
| Molecular Formula | C19H20FN3S2 |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 3-[(2-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2ccccc2F)nnc1-c1csc(CCC)c1 |
| InChI | InChI=1S/C19H20FN3S2/c1-3-7-16-11-15(13-24-16)18-21-22-19(23(18)10-4-2)25-12-14-8-5-6-9-17(14)20/h4-6,8-9,11,13H,2-3,7,10,12H2,1H3 |
| InChIKey | ACGREUJEUCTTEV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|