C20H21ClN4OS2 — CID 19719526
N-(2-chlorophenyl)-2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19719526) has the molecular formula C20H21ClN4OS2 and a molecular weight of 433.00 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19719526 |
| Molecular Formula | C20H21ClN4OS2 |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-(2-chlorophenyl)-2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2Cl)nnc1-c1csc(CCC)c1 |
| InChI | InChI=1S/C20H21ClN4OS2/c1-3-7-15-11-14(12-27-15)19-23-24-20(25(19)10-4-2)28-13-18(26)22-17-9-6-5-8-16(17)21/h4-6,8-9,11-12H,2-3,7,10,13H2,1H3,(H,22,26) |
| InChIKey | YNMHQAFRHACEPH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|