C20H20ClN5O3S2 — CID 19719568
N-(2-chloro-5-nitrophenyl)-2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19719568) has the molecular formula C20H20ClN5O3S2 and a molecular weight of 478.00 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19719568 |
| Molecular Formula | C20H20ClN5O3S2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)nnc1-c1csc(CCC)c1 |
| InChI | InChI=1S/C20H20ClN5O3S2/c1-3-5-15-9-13(11-30-15)19-23-24-20(25(19)8-4-2)31-12-18(27)22-17-10-14(26(28)29)6-7-16(17)21/h4,6-7,9-11H,2-3,5,8,12H2,1H3,(H,22,27) |
| InChIKey | DFFXYYQWPXHJID-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|