C21H24N4OS2 — CID 19719588
N-benzyl-2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19719588) has the molecular formula C21H24N4OS2 and a molecular weight of 412.58 g/mol. Its IUPAC name is N-benzyl-2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-benzyl-2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19719588 |
| Molecular Formula | C21H24N4OS2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-benzyl-2-[[4-prop-2-enyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NCc2ccccc2)nnc1-c1csc(CCC)c1 |
| InChI | InChI=1S/C21H24N4OS2/c1-3-8-18-12-17(14-27-18)20-23-24-21(25(20)11-4-2)28-15-19(26)22-13-16-9-6-5-7-10-16/h4-7,9-10,12,14H,2-3,8,11,13,15H2,1H3,(H,22,26) |
| InChIKey | WAMNKKTXGKYVHL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|