C27H21F3N4OS — CID 46089723
4-[4-(2-methoxyethyl)-5-[(2,3,4-trifluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylquinoline (PubChem CID 46089723) has the molecular formula C27H21F3N4OS and a molecular weight of 506.55 g/mol. Its IUPAC name is 4-[4-(2-methoxyethyl)-5-[(2,3,4-trifluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylquinoline.
| Compound Name | 4-[4-(2-methoxyethyl)-5-[(2,3,4-trifluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylquinoline |
|---|---|
| PubChem CID | 46089723 |
| Molecular Formula | C27H21F3N4OS |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 4-[4-(2-methoxyethyl)-5-[(2,3,4-trifluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]-2-phenylquinoline |
| SMILES | COCCn1c(SCc2ccc(F)c(F)c2F)nnc1-c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C27H21F3N4OS/c1-35-14-13-34-26(32-33-27(34)36-16-18-11-12-21(28)25(30)24(18)29)20-15-23(17-7-3-2-4-8-17)31-22-10-6-5-9-19(20)22/h2-12,15H,13-14,16H2,1H3 |
| InChIKey | YLIUSLLOFMIYHL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|