C29H25FN4O2S — CID 46089617
1-(3-fluorophenyl)-2-[[4-(3-methoxypropyl)-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 46089617) has the molecular formula C29H25FN4O2S and a molecular weight of 512.61 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-[[4-(3-methoxypropyl)-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(3-fluorophenyl)-2-[[4-(3-methoxypropyl)-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 46089617 |
| Molecular Formula | C29H25FN4O2S |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 1-(3-fluorophenyl)-2-[[4-(3-methoxypropyl)-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | COCCCn1c(SCC(=O)c2cccc(F)c2)nnc1-c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C29H25FN4O2S/c1-36-16-8-15-34-28(32-33-29(34)37-19-27(35)21-11-7-12-22(30)17-21)24-18-26(20-9-3-2-4-10-20)31-25-14-6-5-13-23(24)25/h2-7,9-14,17-18H,8,15-16,19H2,1H3 |
| InChIKey | KHHNWFJYJPIRPP-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|