C28H24N4OS — CID 46089513
4-[5-[(4-methoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-phenylquinoline (PubChem CID 46089513) has the molecular formula C28H24N4OS and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-[5-[(4-methoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-phenylquinoline.
| Compound Name | 4-[5-[(4-methoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-phenylquinoline |
|---|---|
| PubChem CID | 46089513 |
| Molecular Formula | C28H24N4OS |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 4-[5-[(4-methoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-phenylquinoline |
| SMILES | C=CCn1c(SCc2ccc(OC)cc2)nnc1-c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C28H24N4OS/c1-3-17-32-27(30-31-28(32)34-19-20-13-15-22(33-2)16-14-20)24-18-26(21-9-5-4-6-10-21)29-25-12-8-7-11-23(24)25/h3-16,18H,1,17,19H2,2H3 |
| InChIKey | DXMSIORLHAAWOK-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|