C17H15ClN6S — CID 133420956
4-chloro-2-cyclopropyl-6-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine (PubChem CID 133420956) has the molecular formula C17H15ClN6S and a molecular weight of 370.87 g/mol. Its IUPAC name is 4-chloro-2-cyclopropyl-6-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine.
| Compound Name | 4-chloro-2-cyclopropyl-6-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine |
|---|---|
| PubChem CID | 133420956 |
| Molecular Formula | C17H15ClN6S |
| Molecular Weight | 370.87 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-chloro-2-cyclopropyl-6-[(4-prop-2-enyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyrimidine |
| SMILES | C=CCn1c(Sc2cc(Cl)nc(C3CC3)n2)nnc1-c1ccccn1 |
| InChI | InChI=1S/C17H15ClN6S/c1-2-9-24-16(12-5-3-4-8-19-12)22-23-17(24)25-14-10-13(18)20-15(21-14)11-6-7-11/h2-5,8,10-11H,1,6-7,9H2 |
| InChIKey | YJYFXSUWTKCLKC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.87 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|