C14H10N6S2 — CID 133492975
5-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyrazine-2-carbonitrile (PubChem CID 133492975) has the molecular formula C14H10N6S2 and a molecular weight of 326.41 g/mol. Its IUPAC name is 5-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyrazine-2-carbonitrile.
| Compound Name | 5-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133492975 |
| Molecular Formula | C14H10N6S2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 5-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]pyrazine-2-carbonitrile |
| SMILES | C=CCn1c(Sc2cnc(C#N)cn2)nnc1-c1cccs1 |
| InChI | InChI=1S/C14H10N6S2/c1-2-5-20-13(11-4-3-6-21-11)18-19-14(20)22-12-9-16-10(7-15)8-17-12/h2-4,6,8-9H,1,5H2 |
| InChIKey | NVBVUOBAAJVFLS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|