C17H15N7S — CID 78833619
2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]imidazo[1,2-a]pyrimidine (PubChem CID 78833619) has the molecular formula C17H15N7S and a molecular weight of 349.42 g/mol. Its IUPAC name is 2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]imidazo[1,2-a]pyrimidine.
| Compound Name | 2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]imidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 78833619 |
| Molecular Formula | C17H15N7S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]imidazo[1,2-a]pyrimidine |
| SMILES | C=CCn1c(SCc2cn3cccnc3n2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C17H15N7S/c1-2-9-24-15(13-4-7-18-8-5-13)21-22-17(24)25-12-14-11-23-10-3-6-19-16(23)20-14/h2-8,10-11H,1,9,12H2 |
| InChIKey | VUBZSDLRHMIVOP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 73.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|