C20H19N5S — CID 19730258
2-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]imidazo[1,2-a]pyridine (PubChem CID 19730258) has the molecular formula C20H19N5S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]imidazo[1,2-a]pyridine.
| Compound Name | 2-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 19730258 |
| Molecular Formula | C20H19N5S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 2-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]imidazo[1,2-a]pyridine |
| SMILES | C=CCn1c(SCc2cn3ccccc3n2)nnc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C20H19N5S/c1-3-11-25-19(16-9-7-15(2)8-10-16)22-23-20(25)26-14-17-13-24-12-5-4-6-18(24)21-17/h3-10,12-13H,1,11,14H2,2H3 |
| InChIKey | OUCBJNAYYLXNFR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|