C20H18BrN5OS — CID 21166741
2-[[5-[(4-bromophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]imidazo[1,2-a]pyridine (PubChem CID 21166741) has the molecular formula C20H18BrN5OS and a molecular weight of 456.37 g/mol. Its IUPAC name is 2-[[5-[(4-bromophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]imidazo[1,2-a]pyridine.
| Compound Name | 2-[[5-[(4-bromophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 21166741 |
| Molecular Formula | C20H18BrN5OS |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 2-[[5-[(4-bromophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]imidazo[1,2-a]pyridine |
| SMILES | C=CCn1c(COc2ccc(Br)cc2)nnc1SCc1cn2ccccc2n1 |
| InChI | InChI=1S/C20H18BrN5OS/c1-2-10-26-19(13-27-17-8-6-15(21)7-9-17)23-24-20(26)28-14-16-12-25-11-4-3-5-18(25)22-16/h2-9,11-12H,1,10,13-14H2 |
| InChIKey | CPVDXMZLXLEFPW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|