C22H22BrN3O2S — CID 21378358
1-(4-bromophenyl)-2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 21378358) has the molecular formula C22H22BrN3O2S and a molecular weight of 472.41 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(4-bromophenyl)-2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 21378358 |
| Molecular Formula | C22H22BrN3O2S |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 1-(4-bromophenyl)-2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | C=CCn1c(COc2ccc(CC)cc2)nnc1SCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H22BrN3O2S/c1-3-13-26-21(14-28-19-11-5-16(4-2)6-12-19)24-25-22(26)29-15-20(27)17-7-9-18(23)10-8-17/h3,5-12H,1,4,13-15H2,2H3 |
| InChIKey | BHEOHHFPAVGEBH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|