C22H25N5OS — CID 19732600
2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]imidazo[1,2-a]pyridine (PubChem CID 19732600) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]imidazo[1,2-a]pyridine.
| Compound Name | 2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 19732600 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]imidazo[1,2-a]pyridine |
| SMILES | CCCCOc1ccc(-c2nnc(SCc3cn4ccccc4n3)n2CC)cc1 |
| InChI | InChI=1S/C22H25N5OS/c1-3-5-14-28-19-11-9-17(10-12-19)21-24-25-22(27(21)4-2)29-16-18-15-26-13-7-6-8-20(26)23-18/h6-13,15H,3-5,14,16H2,1-2H3 |
| InChIKey | OJCULJHPVFBTPM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|