C15H11F3N6O2S — CID 133329054
4-methyl-5-nitro-2-[[5-pyridin-4-yl-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]pyridine (PubChem CID 133329054) has the molecular formula C15H11F3N6O2S and a molecular weight of 396.35 g/mol. Its IUPAC name is 4-methyl-5-nitro-2-[[5-pyridin-4-yl-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]pyridine.
| Compound Name | 4-methyl-5-nitro-2-[[5-pyridin-4-yl-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]pyridine |
|---|---|
| PubChem CID | 133329054 |
| Molecular Formula | C15H11F3N6O2S |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-methyl-5-nitro-2-[[5-pyridin-4-yl-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]pyridine |
| SMILES | Cc1cc(Sc2nnc(-c3ccncc3)n2CC(F)(F)F)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11F3N6O2S/c1-9-6-12(20-7-11(9)24(25)26)27-14-22-21-13(10-2-4-19-5-3-10)23(14)8-15(16,17)18/h2-7H,8H2,1H3 |
| InChIKey | RMEFDYDPBZDTGW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|