C16H16N4O3S2 — CID 46484176
3-[2-(3-nitrophenoxy)ethylsulfanyl]-4-(2-thiophen-2-ylethyl)-1,2,4-triazole (PubChem CID 46484176) has the molecular formula C16H16N4O3S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-[2-(3-nitrophenoxy)ethylsulfanyl]-4-(2-thiophen-2-ylethyl)-1,2,4-triazole.
| Compound Name | 3-[2-(3-nitrophenoxy)ethylsulfanyl]-4-(2-thiophen-2-ylethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 46484176 |
| Molecular Formula | C16H16N4O3S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 3-[2-(3-nitrophenoxy)ethylsulfanyl]-4-(2-thiophen-2-ylethyl)-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cccc(OCCSc2nncn2CCc2cccs2)c1 |
| InChI | InChI=1S/C16H16N4O3S2/c21-20(22)13-3-1-4-14(11-13)23-8-10-25-16-18-17-12-19(16)7-6-15-5-2-9-24-15/h1-5,9,11-12H,6-8,10H2 |
| InChIKey | AKZUNLIEPRNBLF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|