C14H19N3O2S2 — CID 134010901
ethyl 4-[[4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]butanoate (PubChem CID 134010901) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is ethyl 4-[[4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]butanoate.
| Compound Name | ethyl 4-[[4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 134010901 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | ethyl 4-[[4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]butanoate |
| SMILES | CCOC(=O)CCCSc1nncn1CCc1cccs1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-2-19-13(18)6-4-10-21-14-16-15-11-17(14)8-7-12-5-3-9-20-12/h3,5,9,11H,2,4,6-8,10H2,1H3 |
| InChIKey | WBVAFYWMWNNEDE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|