C16H21N5O2S2 — CID 154773697
5,5-dimethyl-3-[3-[[4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione (PubChem CID 154773697) has the molecular formula C16H21N5O2S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 5,5-dimethyl-3-[3-[[4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[3-[[4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154773697 |
| Molecular Formula | C16H21N5O2S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 5,5-dimethyl-3-[3-[[4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCCSc2nncn2CCc2cccs2)C1=O |
| InChI | InChI=1S/C16H21N5O2S2/c1-16(2)13(22)21(14(23)18-16)7-4-10-25-15-19-17-11-20(15)8-6-12-5-3-9-24-12/h3,5,9,11H,4,6-8,10H2,1-2H3,(H,18,23) |
| InChIKey | XALDTFMUPCAMKX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|