C17H23N3O3S — CID 78852295
N-cyclopropyl-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 78852295) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-cyclopropyl-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | N-cyclopropyl-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 78852295 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-cyclopropyl-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | CC1(C)NC(=O)N(CCCC(=O)N(Cc2cccs2)C2CC2)C1=O |
| InChI | InChI=1S/C17H23N3O3S/c1-17(2)15(22)19(16(23)18-17)9-3-6-14(21)20(12-7-8-12)11-13-5-4-10-24-13/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,18,23) |
| InChIKey | KWWMKJPGAGGLAF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|