C19H25N5O2S — CID 78883274
3-[3-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 78883274) has the molecular formula C19H25N5O2S and a molecular weight of 387.51 g/mol. Its IUPAC name is 3-[3-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[3-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 78883274 |
| Molecular Formula | C19H25N5O2S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-[3-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCn1c(SCCCN2C(=O)NC(C)(C)C2=O)nnc1-c1cccc(C)c1 |
| InChI | InChI=1S/C19H25N5O2S/c1-5-23-15(14-9-6-8-13(2)12-14)21-22-18(23)27-11-7-10-24-16(25)19(3,4)20-17(24)26/h6,8-9,12H,5,7,10-11H2,1-4H3,(H,20,26) |
| InChIKey | QRRGGHMEMKRMFO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|