C23H24N4O2S — CID 112781971
2-[4-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butyl]isoindole-1,3-dione (PubChem CID 112781971) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is 2-[4-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 112781971 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-[4-[[4-ethyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butyl]isoindole-1,3-dione |
| SMILES | CCn1c(SCCCCN2C(=O)c3ccccc3C2=O)nnc1-c1cccc(C)c1 |
| InChI | InChI=1S/C23H24N4O2S/c1-3-26-20(17-10-8-9-16(2)15-17)24-25-23(26)30-14-7-6-13-27-21(28)18-11-4-5-12-19(18)22(27)29/h4-5,8-12,15H,3,6-7,13-14H2,1-2H3 |
| InChIKey | KGEGCZMRKWCCPD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|