C14H20N4OS2 — CID 63736966
5-[3-[4-(aminomethyl)phenoxy]propylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 63736966) has the molecular formula C14H20N4OS2 and a molecular weight of 324.48 g/mol. Its IUPAC name is 5-[3-[4-(aminomethyl)phenoxy]propylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[3-[4-(aminomethyl)phenoxy]propylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 63736966 |
| Molecular Formula | C14H20N4OS2 |
| Molecular Weight | 324.48 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 5-[3-[4-(aminomethyl)phenoxy]propylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(SCCCOc2ccc(CN)cc2)s1 |
| InChI | InChI=1S/C14H20N4OS2/c1-18(2)13-16-17-14(21-13)20-9-3-8-19-12-6-4-11(10-15)5-7-12/h4-7H,3,8-10,15H2,1-2H3 |
| InChIKey | MULSJMACROOVAH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|