About 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine
5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 63738508) has the molecular formula C9H16ClN3S2
and a molecular weight of 265.83 g/mol. Its IUPAC name is 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 63738508 |
| Molecular Formula | C9H16ClN3S2 |
| Molecular Weight | 265.83 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(SCCCCCCl)s1 |
| InChI | InChI=1S/C9H16ClN3S2/c1-13(2)8-11-12-9(15-8)14-7-5-3-4-6-10/h3-7H2,1-2H3 |
| InChIKey | MXRAOLWADWCTRO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.83 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine (CID 63738508) is 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine is CN(C)c1nnc(SCCCCCCl)s1.
What is the InChIKey of 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine?
The InChIKey is MXRAOLWADWCTRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClN3S2/c1-13(2)8-11-12-9(15-8)14-7-5-3-4-6-10/h3-7H2,1-2H3.
What are the key properties of 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine?
5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine has a molecular weight of 265.83 g/mol, XLogP of 3.11, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-chloropentylsulfanyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 63738508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).