C12H24N4S2 — CID 55241636
5-[2-(hexylamino)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 55241636) has the molecular formula C12H24N4S2 and a molecular weight of 288.49 g/mol. Its IUPAC name is 5-[2-(hexylamino)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(hexylamino)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 55241636 |
| Molecular Formula | C12H24N4S2 |
| Molecular Weight | 288.49 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 5-[2-(hexylamino)ethylsulfanyl]-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCCCNCCSc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C12H24N4S2/c1-4-5-6-7-8-13-9-10-17-12-15-14-11(18-12)16(2)3/h13H,4-10H2,1-3H3 |
| InChIKey | CMJXHHCDQHXAJW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|