C11H21N3S2 — CID 62577413
N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]hexan-1-amine (PubChem CID 62577413) has the molecular formula C11H21N3S2 and a molecular weight of 259.44 g/mol. Its IUPAC name is N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]hexan-1-amine.
| Compound Name | N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]hexan-1-amine |
|---|---|
| PubChem CID | 62577413 |
| Molecular Formula | C11H21N3S2 |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]hexan-1-amine |
| SMILES | CCCCCCNCCSc1nnc(C)s1 |
| InChI | InChI=1S/C11H21N3S2/c1-3-4-5-6-7-12-8-9-15-11-14-13-10(2)16-11/h12H,3-9H2,1-2H3 |
| InChIKey | LENHVXUDCGWWBT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|