C13H25N3OS2 — CID 64808290
2-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(propylamino)hexan-1-ol (PubChem CID 64808290) has the molecular formula C13H25N3OS2 and a molecular weight of 303.50 g/mol. Its IUPAC name is 2-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(propylamino)hexan-1-ol.
| Compound Name | 2-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(propylamino)hexan-1-ol |
|---|---|
| PubChem CID | 64808290 |
| Molecular Formula | C13H25N3OS2 |
| Molecular Weight | 303.50 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(propylamino)hexan-1-ol |
| SMILES | CCCNC(C)(CO)CCCCSc1nnc(C)s1 |
| InChI | InChI=1S/C13H25N3OS2/c1-4-8-14-13(3,10-17)7-5-6-9-18-12-16-15-11(2)19-12/h14,17H,4-10H2,1-3H3 |
| InChIKey | LKIYBVJSLSRAJC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|