C13H26N4OS2 — CID 64806496
5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propylamino)pentan-1-ol (PubChem CID 64806496) has the molecular formula C13H26N4OS2 and a molecular weight of 318.51 g/mol. Its IUPAC name is 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propylamino)pentan-1-ol.
| Compound Name | 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propylamino)pentan-1-ol |
|---|---|
| PubChem CID | 64806496 |
| Molecular Formula | C13H26N4OS2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propylamino)pentan-1-ol |
| SMILES | CCCNC(C)(CO)CCCSc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C13H26N4OS2/c1-5-8-14-13(2,10-18)7-6-9-19-12-16-15-11(20-12)17(3)4/h14,18H,5-10H2,1-4H3 |
| InChIKey | GXJLTQKQGFQNEZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|