C13H26N4S2 — CID 106808121
N,N-dimethyl-5-[4-(propylamino)hexylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 106808121) has the molecular formula C13H26N4S2 and a molecular weight of 302.51 g/mol. Its IUPAC name is N,N-dimethyl-5-[4-(propylamino)hexylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N,N-dimethyl-5-[4-(propylamino)hexylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 106808121 |
| Molecular Formula | C13H26N4S2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N,N-dimethyl-5-[4-(propylamino)hexylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CCCNC(CC)CCCSc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C13H26N4S2/c1-5-9-14-11(6-2)8-7-10-18-13-16-15-12(19-13)17(3)4/h11,14H,5-10H2,1-4H3 |
| InChIKey | XLNULYZYPHDBHZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|