C13H23NS2 — CID 106808177
N-propyl-6-thiophen-2-ylsulfanylhexan-3-amine (PubChem CID 106808177) has the molecular formula C13H23NS2 and a molecular weight of 257.47 g/mol. Its IUPAC name is N-propyl-6-thiophen-2-ylsulfanylhexan-3-amine.
| Compound Name | N-propyl-6-thiophen-2-ylsulfanylhexan-3-amine |
|---|---|
| PubChem CID | 106808177 |
| Molecular Formula | C13H23NS2 |
| Molecular Weight | 257.47 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-propyl-6-thiophen-2-ylsulfanylhexan-3-amine |
| SMILES | CCCNC(CC)CCCSc1cccs1 |
| InChI | InChI=1S/C13H23NS2/c1-3-9-14-12(4-2)7-5-10-15-13-8-6-11-16-13/h6,8,11-12,14H,3-5,7,9-10H2,1-2H3 |
| InChIKey | CZCKHMPWXAFFAR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|