C12H19NO2S2 — CID 63034472
methyl 2-(propylamino)-4-thiophen-2-ylsulfanylbutanoate (PubChem CID 63034472) has the molecular formula C12H19NO2S2 and a molecular weight of 273.42 g/mol. Its IUPAC name is methyl 2-(propylamino)-4-thiophen-2-ylsulfanylbutanoate.
| Compound Name | methyl 2-(propylamino)-4-thiophen-2-ylsulfanylbutanoate |
|---|---|
| PubChem CID | 63034472 |
| Molecular Formula | C12H19NO2S2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | methyl 2-(propylamino)-4-thiophen-2-ylsulfanylbutanoate |
| SMILES | CCCNC(CCSc1cccs1)C(=O)OC |
| InChI | InChI=1S/C12H19NO2S2/c1-3-7-13-10(12(14)15-2)6-9-17-11-5-4-8-16-11/h4-5,8,10,13H,3,6-7,9H2,1-2H3 |
| InChIKey | LKYNUGFPOUGXOW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |