C17H29NO4 — CID 174808720
methyl 4-hydroxy-2-(propylamino)butanoate;3-phenylpropan-1-ol (PubChem CID 174808720) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is methyl 4-hydroxy-2-(propylamino)butanoate;3-phenylpropan-1-ol.
| Compound Name | methyl 4-hydroxy-2-(propylamino)butanoate;3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 174808720 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | methyl 4-hydroxy-2-(propylamino)butanoate;3-phenylpropan-1-ol |
| SMILES | CCCNC(CCO)C(=O)OC.OCCCc1ccccc1 |
| InChI | InChI=1S/C9H12O.C8H17NO3/c10-8-4-7-9-5-2-1-3-6-9;1-3-5-9-7(4-6-10)8(11)12-2/h1-3,5-6,10H,4,7-8H2;7,9-10H,3-6H2,1-2H3 |
| InChIKey | CSHYLZROUKYRIT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |