C25H37N3O7 — CID 174963682
bis(2-amino-3-phenylpropanoic acid);4-hydroxy-2-(propylamino)butanoic acid (PubChem CID 174963682) has the molecular formula C25H37N3O7 and a molecular weight of 491.59 g/mol. Its IUPAC name is bis(2-amino-3-phenylpropanoic acid);4-hydroxy-2-(propylamino)butanoic acid.
| Compound Name | bis(2-amino-3-phenylpropanoic acid);4-hydroxy-2-(propylamino)butanoic acid |
|---|---|
| PubChem CID | 174963682 |
| Molecular Formula | C25H37N3O7 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | bis(2-amino-3-phenylpropanoic acid);4-hydroxy-2-(propylamino)butanoic acid |
| SMILES | CCCNC(CCO)C(=O)O.NC(Cc1ccccc1)C(=O)O.NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/2C9H11NO2.C7H15NO3/c2*10-8(9(11)12)6-7-4-2-1-3-5-7;1-2-4-8-6(3-5-9)7(10)11/h2*1-5,8H,6,10H2,(H,11,12);6,8-9H,2-5H2,1H3,(H,10,11) |
| InChIKey | BAMDKKBVGRSPLH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 196.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |