C19H32ClNO6 — CID 174956567
ethyl carbonochloridate;4-hydroxy-2-(propylamino)butanoic acid;3-phenylpropan-1-ol (PubChem CID 174956567) has the molecular formula C19H32ClNO6 and a molecular weight of 405.92 g/mol. Its IUPAC name is ethyl carbonochloridate;4-hydroxy-2-(propylamino)butanoic acid;3-phenylpropan-1-ol.
| Compound Name | ethyl carbonochloridate;4-hydroxy-2-(propylamino)butanoic acid;3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 174956567 |
| Molecular Formula | C19H32ClNO6 |
| Molecular Weight | 405.92 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | ethyl carbonochloridate;4-hydroxy-2-(propylamino)butanoic acid;3-phenylpropan-1-ol |
| SMILES | CCCNC(CCO)C(=O)O.CCOC(=O)Cl.OCCCc1ccccc1 |
| InChI | InChI=1S/C9H12O.C7H15NO3.C3H5ClO2/c10-8-4-7-9-5-2-1-3-6-9;1-2-4-8-6(3-5-9)7(10)11;1-2-6-3(4)5/h1-3,5-6,10H,4,7-8H2;6,8-9H,2-5H2,1H3,(H,10,11);2H2,1H3 |
| InChIKey | HBXNYYAHRWKMIY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.92 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|